About butane;ethane;N-methylbut-3-en-2-imine
butane;ethane;N-methylbut-3-en-2-imine (PubChem CID 177235637) has the molecular formula C13H31N
and a molecular weight of 201.40 g/mol. Its IUPAC name is butane;ethane;N-methylbut-3-en-2-imine.
Molecular Properties
| Compound Name | butane;ethane;N-methylbut-3-en-2-imine |
| PubChem CID | 177235637 |
| Molecular Formula | C13H31N |
| Molecular Weight | 201.40 g/mol |
| Exact Mass | 201.25 |
| IUPAC Name | butane;ethane;N-methylbut-3-en-2-imine |
| SMILES | C=C/C(C)=N/C.CC.CC.CCCC |
| InChI | InChI=1S/C5H9N.C4H10.2C2H6/c1-4-5(2)6-3;1-3-4-2;2*1-2/h4H,1H2,2-3H3;3-4H2,1-2H3;2*1-2H3/b6-5+;;; |
| InChIKey | SVHNLQFPRZYFAQ-FWMLTEASSA-N |
| XLogP | 5.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 201.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane;ethane;N-methylbut-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;N-methylbut-3-en-2-imine?
The IUPAC name of butane;ethane;N-methylbut-3-en-2-imine (CID 177235637) is butane;ethane;N-methylbut-3-en-2-imine.
What is the SMILES notation for butane;ethane;N-methylbut-3-en-2-imine?
The canonical SMILES for butane;ethane;N-methylbut-3-en-2-imine is C=C/C(C)=N/C.CC.CC.CCCC.
What is the InChIKey of butane;ethane;N-methylbut-3-en-2-imine?
The InChIKey is SVHNLQFPRZYFAQ-FWMLTEASSA-N. The full InChI is InChI=1S/C5H9N.C4H10.2C2H6/c1-4-5(2)6-3;1-3-4-2;2*1-2/h4H,1H2,2-3H3;3-4H2,1-2H3;2*1-2H3/b6-5+;;;.
What are the key properties of butane;ethane;N-methylbut-3-en-2-imine?
butane;ethane;N-methylbut-3-en-2-imine has a molecular weight of 201.40 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;N-methylbut-3-en-2-imine is sourced from PubChem (CID 177235637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).