C20H16F8N6O4S — CID 177236040
2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-[1-(trifluoromethyl)cyclopropyl]pyrazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 177236040) has the molecular formula C20H16F8N6O4S and a molecular weight of 588.44 g/mol. Its IUPAC name is 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-[1-(trifluoromethyl)cyclopropyl]pyrazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-[1-(trifluoromethyl)cyclopropyl]pyrazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 177236040 |
| Molecular Formula | C20H16F8N6O4S |
| Molecular Weight | 588.44 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | 2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-N-[1-(trifluoromethyl)cyclopropyl]pyrazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | CCS(=O)(=O)c1nn2c(C(=O)NC3(C(F)(F)F)CC3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H16F8N6O4S/c1-2-39(36,37)16-13(10-7-31-12(8-30-10)38-9-18(21,22)20(26,27)28)14-29-6-3-11(34(14)33-16)15(35)32-17(4-5-17)19(23,24)25/h3,6-8H,2,4-5,9H2,1H3,(H,32,35) |
| InChIKey | BPKQEWPJRRRBBW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|