C20H19F5N6O5S — CID 177236047
N-(cyclopropylmethoxy)-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 177236047) has the molecular formula C20H19F5N6O5S and a molecular weight of 550.47 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | N-(cyclopropylmethoxy)-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 177236047 |
| Molecular Formula | C20H19F5N6O5S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | N-(cyclopropylmethoxy)-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | CCS(=O)(=O)c1nn2c(C(=O)NOCC3CC3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H19F5N6O5S/c1-2-37(33,34)18-15(12-7-28-14(8-27-12)35-10-19(21,22)20(23,24)25)16-26-6-5-13(31(16)29-18)17(32)30-36-9-11-3-4-11/h5-8,11H,2-4,9-10H2,1H3,(H,30,32) |
| InChIKey | FHHBNMLIQGOUMD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|