C18H16F5N5O4S — CID 177236064
ethyl 2-ethylsulfinyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxylate (PubChem CID 177236064) has the molecular formula C18H16F5N5O4S and a molecular weight of 493.41 g/mol. Its IUPAC name is ethyl 2-ethylsulfinyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxylate.
| Compound Name | ethyl 2-ethylsulfinyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 177236064 |
| Molecular Formula | C18H16F5N5O4S |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | ethyl 2-ethylsulfinyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine-7-carboxylate |
| SMILES | CCOC(=O)c1ccnc2c(-c3cnc(OCC(F)(F)C(F)(F)F)cn3)c(S(=O)CC)nn12 |
| InChI | InChI=1S/C18H16F5N5O4S/c1-3-31-16(29)11-5-6-24-14-13(15(27-28(11)14)33(30)4-2)10-7-26-12(8-25-10)32-9-17(19,20)18(21,22)23/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | LVXQPNAFZJBOJS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 108.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|