C14H12N2O — CID 177237561
3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde (PubChem CID 177237561) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde.
| Compound Name | 3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde |
|---|---|
| PubChem CID | 177237561 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde |
| SMILES | O=Cc1cc2c(nn1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C14H12N2O/c17-9-12-8-11-6-3-5-10-4-1-2-7-13(10)14(11)16-15-12/h1-2,4,7-9H,3,5-6H2 |
| InChIKey | UOIFUFLUHJKDBA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|