C26H32ClF3N6 — CID 177237731
2-(6-chloro-4-methyl-2-pyridinyl)-N-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-amine;ethane (PubChem CID 177237731) has the molecular formula C26H32ClF3N6 and a molecular weight of 521.03 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-pyridinyl)-N-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-amine;ethane.
| Compound Name | 2-(6-chloro-4-methyl-2-pyridinyl)-N-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-amine;ethane |
|---|---|
| PubChem CID | 177237731 |
| Molecular Formula | C26H32ClF3N6 |
| Molecular Weight | 521.03 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-pyridinyl)-N-(7-pyrrolidin-1-yl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-amine;ethane |
| SMILES | CC.Cc1cc(Cl)nc(-n2nc(C(F)(F)F)nc2Nc2ccc3c(c2)CCC(N2CCCC2)CC3)c1 |
| InChI | InChI=1S/C24H26ClF3N6.C2H6/c1-15-12-20(25)30-21(13-15)34-23(31-22(32-34)24(26,27)28)29-18-7-4-16-5-8-19(9-6-17(16)14-18)33-10-2-3-11-33;1-2/h4,7,12-14,19H,2-3,5-6,8-11H2,1H3,(H,29,31,32);1-2H3 |
| InChIKey | KAZIYFJXBOPWKN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.03 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|