C6H6IN3O — CID 177238249
4-methoxy-8λ3-ioda-1,7,9-triazabicyclo[4.3.0]nona-2,4,6,8-tetraene (PubChem CID 177238249) has the molecular formula C6H6IN3O and a molecular weight of 263.04 g/mol. Its IUPAC name is 4-methoxy-8λ3-ioda-1,7,9-triazabicyclo[4.3.0]nona-2,4,6,8-tetraene.
| Compound Name | 4-methoxy-8λ3-ioda-1,7,9-triazabicyclo[4.3.0]nona-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 177238249 |
| Molecular Formula | C6H6IN3O |
| Molecular Weight | 263.04 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 4-methoxy-8λ3-ioda-1,7,9-triazabicyclo[4.3.0]nona-2,4,6,8-tetraene |
| SMILES | COC1=CC2=NI=NN2C=C1 |
| InChI | InChI=1S/C6H6IN3O/c1-11-5-2-3-10-6(4-5)8-7-9-10/h2-4H,1H3 |
| InChIKey | NLDRSIIIWXUKAA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.04 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|