C26H22Cl3F2N3O5S — CID 177238315
N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-hydroxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide (PubChem CID 177238315) has the molecular formula C26H22Cl3F2N3O5S and a molecular weight of 632.90 g/mol. Its IUPAC name is N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-hydroxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide.
| Compound Name | N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-hydroxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide |
|---|---|
| PubChem CID | 177238315 |
| Molecular Formula | C26H22Cl3F2N3O5S |
| Molecular Weight | 632.90 g/mol |
| Exact Mass | 631.03 |
| IUPAC Name | N-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-6-hydroxy-1,3-dihydroisoindol-5-yl]-N-(3-methoxypropyl)formamide |
| SMILES | COCCCN(C=O)c1cc2c(cc1O)CN(C(=O)c1c(Sc3c(Cl)cccc3Cl)cc(C(F)(F)Cl)[nH]c1=O)C2 |
| InChI | InChI=1S/C26H22Cl3F2N3O5S/c1-39-7-3-6-33(13-35)18-8-14-11-34(12-15(14)9-19(18)36)25(38)22-20(10-21(26(29,30)31)32-24(22)37)40-23-16(27)4-2-5-17(23)28/h2,4-5,8-10,13,36H,3,6-7,11-12H2,1H3,(H,32,37) |
| InChIKey | OQSFTFWTZOTZCL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.90 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|