C28H24Cl3F2N3O7S — CID 177238325
2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-[5-[formyl(3-methoxypropyl)amino]-6-methoxy-1,3-dihydroisoindole-2-carbonyl]-2-oxo-1H-pyridin-4-yl]sulfanyl]benzoic acid (PubChem CID 177238325) has the molecular formula C28H24Cl3F2N3O7S and a molecular weight of 690.94 g/mol. Its IUPAC name is 2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-[5-[formyl(3-methoxypropyl)amino]-6-methoxy-1,3-dihydroisoindole-2-carbonyl]-2-oxo-1H-pyridin-4-yl]sulfanyl]benzoic acid.
| Compound Name | 2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-[5-[formyl(3-methoxypropyl)amino]-6-methoxy-1,3-dihydroisoindole-2-carbonyl]-2-oxo-1H-pyridin-4-yl]sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 177238325 |
| Molecular Formula | C28H24Cl3F2N3O7S |
| Molecular Weight | 690.94 g/mol |
| Exact Mass | 689.04 |
| IUPAC Name | 2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-[5-[formyl(3-methoxypropyl)amino]-6-methoxy-1,3-dihydroisoindole-2-carbonyl]-2-oxo-1H-pyridin-4-yl]sulfanyl]benzoic acid |
| SMILES | COCCCN(C=O)c1cc2c(cc1OC)CN(C(=O)c1c(Sc3c(Cl)ccc(C(=O)O)c3Cl)cc(C(F)(F)Cl)[nH]c1=O)C2 |
| InChI | InChI=1S/C28H24Cl3F2N3O7S/c1-42-7-3-6-35(13-37)18-8-14-11-36(12-15(14)9-19(18)43-2)26(39)22-20(10-21(28(31,32)33)34-25(22)38)44-24-17(29)5-4-16(23(24)30)27(40)41/h4-5,8-10,13H,3,6-7,11-12H2,1-2H3,(H,34,38)(H,40,41) |
| InChIKey | FMHOXGHNJBNPNW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 129.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.94 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|