C15H13Cl2F2NO3S — CID 177238424
4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-2-oxo-1H-pyridine-3-carbaldehyde;methanol (PubChem CID 177238424) has the molecular formula C15H13Cl2F2NO3S and a molecular weight of 396.24 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-2-oxo-1H-pyridine-3-carbaldehyde;methanol.
| Compound Name | 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-2-oxo-1H-pyridine-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 177238424 |
| Molecular Formula | C15H13Cl2F2NO3S |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-2-oxo-1H-pyridine-3-carbaldehyde;methanol |
| SMILES | CC(F)(F)c1cc(Sc2c(Cl)cccc2Cl)c(C=O)c(=O)[nH]1.CO |
| InChI | InChI=1S/C14H9Cl2F2NO2S.CH4O/c1-14(17,18)11-5-10(7(6-20)13(21)19-11)22-12-8(15)3-2-4-9(12)16;1-2/h2-6H,1H3,(H,19,21);2H,1H3 |
| InChIKey | GOBNDSWUMHFJQG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|