C16H20N3O3+ — CID 177238815
1-cyclopropyl-3-(6-hydroxy-7-methyl-2-oxo-1,3-dihydroisoindol-2-ium-5-yl)-1,3-diazinan-2-one (PubChem CID 177238815) has the molecular formula C16H20N3O3+ and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-cyclopropyl-3-(6-hydroxy-7-methyl-2-oxo-1,3-dihydroisoindol-2-ium-5-yl)-1,3-diazinan-2-one.
| Compound Name | 1-cyclopropyl-3-(6-hydroxy-7-methyl-2-oxo-1,3-dihydroisoindol-2-ium-5-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 177238815 |
| Molecular Formula | C16H20N3O3+ |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-cyclopropyl-3-(6-hydroxy-7-methyl-2-oxo-1,3-dihydroisoindol-2-ium-5-yl)-1,3-diazinan-2-one |
| SMILES | Cc1c(O)c(N2CCCN(C3CC3)C2=O)cc2c1C[N+](=O)C2 |
| InChI | InChI=1S/C16H19N3O3/c1-10-13-9-17(22)8-11(13)7-14(15(10)20)19-6-2-5-18(16(19)21)12-3-4-12/h7,12H,2-6,8-9H2,1H3/p+1 |
| InChIKey | CGJRDDFEJWXDQX-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|