About 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one
1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one (PubChem CID 177238928) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one |
| PubChem CID | 177238928 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one |
| SMILES | CN1CCCN(c2ccc3c(c2O)CNC3)C1=O |
| InChI | InChI=1S/C13H17N3O2/c1-15-5-2-6-16(13(15)18)11-4-3-9-7-14-8-10(9)12(11)17/h3-4,14,17H,2,5-8H2,1H3 |
| InChIKey | DDKZPMYPRDLVAK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one?
The IUPAC name of 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one (CID 177238928) is 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one.
What is the SMILES notation for 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one?
The canonical SMILES for 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one is CN1CCCN(c2ccc3c(c2O)CNC3)C1=O.
What is the InChIKey of 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one?
The InChIKey is DDKZPMYPRDLVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-15-5-2-6-16(13(15)18)11-4-3-9-7-14-8-10(9)12(11)17/h3-4,14,17H,2,5-8H2,1H3.
What are the key properties of 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one?
1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one has a molecular weight of 247.30 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-2,3-dihydro-1H-isoindol-5-yl)-3-methyl-1,3-diazinan-2-one is sourced from PubChem (CID 177238928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).