C27H19Cl3F6N4O4S — CID 177239232
1-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-7-fluoro-6-hydroxy-1,3-dihydroisoindol-5-yl]-3-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one (PubChem CID 177239232) has the molecular formula C27H19Cl3F6N4O4S and a molecular weight of 715.89 g/mol. Its IUPAC name is 1-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-7-fluoro-6-hydroxy-1,3-dihydroisoindol-5-yl]-3-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one.
| Compound Name | 1-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-7-fluoro-6-hydroxy-1,3-dihydroisoindol-5-yl]-3-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 177239232 |
| Molecular Formula | C27H19Cl3F6N4O4S |
| Molecular Weight | 715.89 g/mol |
| Exact Mass | 714.01 |
| IUPAC Name | 1-[2-[6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-2-oxo-1H-pyridine-3-carbonyl]-7-fluoro-6-hydroxy-1,3-dihydroisoindol-5-yl]-3-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
| SMILES | O=C(c1c(Sc2c(Cl)cccc2Cl)cc(C(F)(F)Cl)[nH]c1=O)N1Cc2cc(N3CCCN(CC(F)(F)F)C3=O)c(O)c(F)c2C1 |
| InChI | InChI=1S/C27H19Cl3F6N4O4S/c28-14-3-1-4-15(29)22(14)45-17-8-18(27(30,35)36)37-23(42)19(17)24(43)39-9-12-7-16(21(41)20(31)13(12)10-39)40-6-2-5-38(25(40)44)11-26(32,33)34/h1,3-4,7-8,41H,2,5-6,9-11H2,(H,37,42) |
| InChIKey | VMWQWWRKJHCGCH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.89 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|