C14H7Cl4F2NO3S — CID 177239293
6-[chloro(difluoro)methyl]-4-[2,6-dichloro-3-(hydroxymethyl)phenyl]sulfanyl-2-oxo-1H-pyridine-3-carbonyl chloride (PubChem CID 177239293) has the molecular formula C14H7Cl4F2NO3S and a molecular weight of 449.09 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-4-[2,6-dichloro-3-(hydroxymethyl)phenyl]sulfanyl-2-oxo-1H-pyridine-3-carbonyl chloride.
| Compound Name | 6-[chloro(difluoro)methyl]-4-[2,6-dichloro-3-(hydroxymethyl)phenyl]sulfanyl-2-oxo-1H-pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 177239293 |
| Molecular Formula | C14H7Cl4F2NO3S |
| Molecular Weight | 449.09 g/mol |
| Exact Mass | 446.89 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-4-[2,6-dichloro-3-(hydroxymethyl)phenyl]sulfanyl-2-oxo-1H-pyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Sc2c(Cl)ccc(CO)c2Cl)cc(C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C14H7Cl4F2NO3S/c15-6-2-1-5(4-22)10(16)11(6)25-7-3-8(14(18,19)20)21-13(24)9(7)12(17)23/h1-3,22H,4H2,(H,21,24) |
| InChIKey | UABXCOILEZIRPD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.09 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|