C15H13Cl2F2NO3S — CID 177239567
4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;formic acid (PubChem CID 177239567) has the molecular formula C15H13Cl2F2NO3S and a molecular weight of 396.24 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;formic acid.
| Compound Name | 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;formic acid |
|---|---|
| PubChem CID | 177239567 |
| Molecular Formula | C15H13Cl2F2NO3S |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 4-(2,6-dichlorophenyl)sulfanyl-6-(1,1-difluoroethyl)-3-methyl-1H-pyridin-2-one;formic acid |
| SMILES | Cc1c(Sc2c(Cl)cccc2Cl)cc(C(C)(F)F)[nH]c1=O.O=CO |
| InChI | InChI=1S/C14H11Cl2F2NOS.CH2O2/c1-7-10(6-11(14(2,17)18)19-13(7)20)21-12-8(15)4-3-5-9(12)16;2-1-3/h3-6H,1-2H3,(H,19,20);1H,(H,2,3) |
| InChIKey | ODYQODDMSITEST-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|