C21H19Cl3F2N2O4S — CID 177239616
tert-butyl 3-[2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-formyl-2-oxo-1H-pyridin-4-yl]sulfanyl]phenyl]azetidine-1-carboxylate (PubChem CID 177239616) has the molecular formula C21H19Cl3F2N2O4S and a molecular weight of 539.82 g/mol. Its IUPAC name is tert-butyl 3-[2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-formyl-2-oxo-1H-pyridin-4-yl]sulfanyl]phenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-formyl-2-oxo-1H-pyridin-4-yl]sulfanyl]phenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 177239616 |
| Molecular Formula | C21H19Cl3F2N2O4S |
| Molecular Weight | 539.82 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | tert-butyl 3-[2,4-dichloro-3-[[6-[chloro(difluoro)methyl]-3-formyl-2-oxo-1H-pyridin-4-yl]sulfanyl]phenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(Cl)c(Sc3cc(C(F)(F)Cl)[nH]c(=O)c3C=O)c2Cl)C1 |
| InChI | InChI=1S/C21H19Cl3F2N2O4S/c1-20(2,3)32-19(31)28-7-10(8-28)11-4-5-13(22)17(16(11)23)33-14-6-15(21(24,25)26)27-18(30)12(14)9-29/h4-6,9-10H,7-8H2,1-3H3,(H,27,30) |
| InChIKey | HHCCGFPFSXOUGW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.82 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|