About [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite
[4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite (PubChem CID 177239667) has the molecular formula C13H7Cl2F3INO2S2
and a molecular weight of 528.14 g/mol. Its IUPAC name is [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite.
Molecular Properties
| Compound Name | [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite |
| PubChem CID | 177239667 |
| Molecular Formula | C13H7Cl2F3INO2S2 |
| Molecular Weight | 528.14 g/mol |
| Exact Mass | 526.83 |
| IUPAC Name | [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite |
| SMILES | O=c1[nH]c(C(F)(F)F)cc(Sc2c(Cl)cccc2Cl)c1COSI |
| InChI | InChI=1S/C13H7Cl2F3INO2S2/c14-7-2-1-3-8(15)11(7)23-9-4-10(13(16,17)18)20-12(21)6(9)5-22-24-19/h1-4H,5H2,(H,20,21) |
| InChIKey | LPMJZOUELFQGKI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.14 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite?
The IUPAC name of [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite (CID 177239667) is [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite.
What is the SMILES notation for [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite?
The canonical SMILES for [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite is O=c1[nH]c(C(F)(F)F)cc(Sc2c(Cl)cccc2Cl)c1COSI.
What is the InChIKey of [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite?
The InChIKey is LPMJZOUELFQGKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl2F3INO2S2/c14-7-2-1-3-8(15)11(7)23-9-4-10(13(16,17)18)20-12(21)6(9)5-22-24-19/h1-4H,5H2,(H,20,21).
What are the key properties of [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite?
[4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite has a molecular weight of 528.14 g/mol, XLogP of 6.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,6-dichlorophenyl)sulfanyl-2-oxo-6-(trifluoromethyl)-1H-pyridin-3-yl]methoxy thiohypoiodite is sourced from PubChem (CID 177239667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).