About N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide
N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide (PubChem CID 177239778) has the molecular formula C11H24NO3P
and a molecular weight of 249.29 g/mol. Its IUPAC name is N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide |
| PubChem CID | 177239778 |
| Molecular Formula | C11H24NO3P |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide |
| SMILES | COCC(C)(C)COCP(C)CNC(C)=O |
| InChI | InChI=1S/C11H24NO3P/c1-10(13)12-8-16(5)9-15-7-11(2,3)6-14-4/h6-9H2,1-5H3,(H,12,13) |
| InChIKey | BXHUAFBGWDZQRD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide?
The IUPAC name of N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide (CID 177239778) is N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide.
What is the SMILES notation for N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide?
The canonical SMILES for N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide is COCC(C)(C)COCP(C)CNC(C)=O.
What is the InChIKey of N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide?
The InChIKey is BXHUAFBGWDZQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24NO3P/c1-10(13)12-8-16(5)9-15-7-11(2,3)6-14-4/h6-9H2,1-5H3,(H,12,13).
What are the key properties of N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide?
N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide has a molecular weight of 249.29 g/mol, XLogP of 1.84, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3-methoxy-2,2-dimethylpropoxy)methyl-methylphosphanyl]methyl]acetamide is sourced from PubChem (CID 177239778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).