C16H24N2O3 — CID 177240198
(3Z,4Z)-3-ethylidene-N-(5-formamido-5-oxopentan-2-yl)-5-methylhepta-4,6-dienamide (PubChem CID 177240198) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3Z,4Z)-3-ethylidene-N-(5-formamido-5-oxopentan-2-yl)-5-methylhepta-4,6-dienamide.
| Compound Name | (3Z,4Z)-3-ethylidene-N-(5-formamido-5-oxopentan-2-yl)-5-methylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 177240198 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3Z,4Z)-3-ethylidene-N-(5-formamido-5-oxopentan-2-yl)-5-methylhepta-4,6-dienamide |
| SMILES | C=C/C(C)=C\C(=C/C)CC(=O)NC(C)CCC(=O)NC=O |
| InChI | InChI=1S/C16H24N2O3/c1-5-12(3)9-14(6-2)10-16(21)18-13(4)7-8-15(20)17-11-19/h5-6,9,11,13H,1,7-8,10H2,2-4H3,(H,18,21)(H,17,19,20)/b12-9-,14-6+ |
| InChIKey | HDDNEOBYTQRVBE-TTXSMSCVSA-N |
| XLogP | 2.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|