About ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine
ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine (PubChem CID 177240244) has the molecular formula C14H29FN4O
and a molecular weight of 288.41 g/mol. Its IUPAC name is ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine.
Molecular Properties
| Compound Name | ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine |
| PubChem CID | 177240244 |
| Molecular Formula | C14H29FN4O |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine |
| SMILES | CC.CN(C1CCN(F)CC1)C1COC2(C1)CN(N)C2 |
| InChI | InChI=1S/C12H23FN4O.C2H6/c1-15(10-2-4-16(13)5-3-10)11-6-12(18-7-11)8-17(14)9-12;1-2/h10-11H,2-9,14H2,1H3;1-2H3 |
| InChIKey | JJFVEEXDZPJVRC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 44.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine?
The IUPAC name of ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine (CID 177240244) is ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine.
What is the SMILES notation for ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine?
The canonical SMILES for ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine is CC.CN(C1CCN(F)CC1)C1COC2(C1)CN(N)C2.
What is the InChIKey of ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine?
The InChIKey is JJFVEEXDZPJVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23FN4O.C2H6/c1-15(10-2-4-16(13)5-3-10)11-6-12(18-7-11)8-17(14)9-12;1-2/h10-11H,2-9,14H2,1H3;1-2H3.
What are the key properties of ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine?
ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine has a molecular weight of 288.41 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-N-(1-fluoropiperidin-4-yl)-7-N-methyl-5-oxa-2-azaspiro[3.4]octane-2,7-diamine is sourced from PubChem (CID 177240244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).