C18H29N3O3 — CID 177240393
ethane;3-[(4E,5E)-5-ethylidene-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione (PubChem CID 177240393) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is ethane;3-[(4E,5E)-5-ethylidene-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[(4E,5E)-5-ethylidene-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177240393 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | ethane;3-[(4E,5E)-5-ethylidene-6-oxo-4-propylidenepyrimidin-1-yl]piperidine-2,6-dione |
| SMILES | C/C=c1/c(=O)n(C2CCC(=O)NC2=O)cn/c1=C/CC.CC.CC |
| InChI | InChI=1S/C14H17N3O3.2C2H6/c1-3-5-10-9(4-2)14(20)17(8-15-10)11-6-7-12(18)16-13(11)19;2*1-2/h4-5,8,11H,3,6-7H2,1-2H3,(H,16,18,19);2*1-2H3/b9-4+,10-5+;; |
| InChIKey | ITMRZXORWCRDTH-ZIDMWSFOSA-N |
| XLogP | 1.26 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|