C28H27F2NO — CID 177241085
6-[(Z)-1-[1-[4-(1,1-difluoropropyl)phenyl]prop-2-ynylideneamino]prop-1-enyl]-5-ethyl-2-methylidene-3,4-dihydronaphthalen-1-one (PubChem CID 177241085) has the molecular formula C28H27F2NO and a molecular weight of 431.53 g/mol. Its IUPAC name is 6-[(Z)-1-[1-[4-(1,1-difluoropropyl)phenyl]prop-2-ynylideneamino]prop-1-enyl]-5-ethyl-2-methylidene-3,4-dihydronaphthalen-1-one.
| Compound Name | 6-[(Z)-1-[1-[4-(1,1-difluoropropyl)phenyl]prop-2-ynylideneamino]prop-1-enyl]-5-ethyl-2-methylidene-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 177241085 |
| Molecular Formula | C28H27F2NO |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 6-[(Z)-1-[1-[4-(1,1-difluoropropyl)phenyl]prop-2-ynylideneamino]prop-1-enyl]-5-ethyl-2-methylidene-3,4-dihydronaphthalen-1-one |
| SMILES | C#C/C(=N\C(=C/C)c1ccc2c(c1CC)CCC(=C)C2=O)c1ccc(C(F)(F)CC)cc1 |
| InChI | InChI=1S/C28H27F2NO/c1-6-21-22-15-10-18(5)27(32)24(22)17-16-23(21)26(8-3)31-25(7-2)19-11-13-20(14-12-19)28(29,30)9-4/h2,8,11-14,16-17H,5-6,9-10,15H2,1,3-4H3/b26-8-,31-25+ |
| InChIKey | UUJRNYDBLBSKIF-UULNXBBASA-N |
| XLogP | 6.92 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|