C21H18N4O3 — CID 177241260
3-[6-(1-methylindazol-3-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177241260) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-[6-(1-methylindazol-3-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(1-methylindazol-3-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177241260 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-[6-(1-methylindazol-3-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c2ccccc21 |
| InChI | InChI=1S/C21H18N4O3/c1-24-16-5-3-2-4-15(16)19(23-24)12-6-7-14-13(10-12)11-25(21(14)28)17-8-9-18(26)22-20(17)27/h2-7,10,17H,8-9,11H2,1H3,(H,22,26,27) |
| InChIKey | GYXXNTASSMTHTC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|