C11H23N3O — CID 177241613
ethane;(E)-5-(ethylideneamino)-4-methyl-2-(methylamino)pent-4-enamide (PubChem CID 177241613) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is ethane;(E)-5-(ethylideneamino)-4-methyl-2-(methylamino)pent-4-enamide.
| Compound Name | ethane;(E)-5-(ethylideneamino)-4-methyl-2-(methylamino)pent-4-enamide |
|---|---|
| PubChem CID | 177241613 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | ethane;(E)-5-(ethylideneamino)-4-methyl-2-(methylamino)pent-4-enamide |
| SMILES | C/C=N/C=C(\C)CC(NC)C(N)=O.CC |
| InChI | InChI=1S/C9H17N3O.C2H6/c1-4-12-6-7(2)5-8(11-3)9(10)13;1-2/h4,6,8,11H,5H2,1-3H3,(H2,10,13);1-2H3/b7-6+,12-4+; |
| InChIKey | NLDKEJXXCAGTNI-CSROAXMKSA-N |
| XLogP | 1.47 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|