C15H19NO — CID 177242343
2-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]aniline (PubChem CID 177242343) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]aniline.
| Compound Name | 2-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]aniline |
|---|---|
| PubChem CID | 177242343 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]aniline |
| SMILES | C=C/C=C(\C=C/CC)OCc1ccccc1N |
| InChI | InChI=1S/C15H19NO/c1-3-5-10-14(8-4-2)17-12-13-9-6-7-11-15(13)16/h4-11H,2-3,12,16H2,1H3/b10-5-,14-8+ |
| InChIKey | SIXHRQIPCREWER-ZLWVQWRBSA-N |
| XLogP | 3.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|