C14H22 — CID 177243443
ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methylbicyclo[1.1.1]pentane (PubChem CID 177243443) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methylbicyclo[1.1.1]pentane.
| Compound Name | ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methylbicyclo[1.1.1]pentane |
|---|---|
| PubChem CID | 177243443 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-3-methylbicyclo[1.1.1]pentane |
| SMILES | C=C/C=C\C(=C)C12CC(C)(C1)C2.CC |
| InChI | InChI=1S/C12H16.C2H6/c1-4-5-6-10(2)12-7-11(3,8-12)9-12;1-2/h4-6H,1-2,7-9H2,3H3;1-2H3/b6-5-; |
| InChIKey | ZGUVZKJHGNYXKP-YSMBQZINSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|