About 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide
2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide (PubChem CID 177243621) has the molecular formula C18H24ClN3O3
and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide.
Molecular Properties
| Compound Name | 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide |
| PubChem CID | 177243621 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide |
| SMILES | CCCC(C=O)N1Cc2c(Cl)cc(C3(N)CC3)cc2C1=O.CNC=O |
| InChI | InChI=1S/C16H19ClN2O2.C2H5NO/c1-2-3-11(9-20)19-8-13-12(15(19)21)6-10(7-14(13)17)16(18)4-5-16;1-3-2-4/h6-7,9,11H,2-5,8,18H2,1H3;2H,1H3,(H,3,4) |
| InChIKey | SCNOCQJFQABRTR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide?
The IUPAC name of 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide (CID 177243621) is 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide.
What is the SMILES notation for 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide?
The canonical SMILES for 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide is CCCC(C=O)N1Cc2c(Cl)cc(C3(N)CC3)cc2C1=O.CNC=O.
What is the InChIKey of 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide?
The InChIKey is SCNOCQJFQABRTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O2.C2H5NO/c1-2-3-11(9-20)19-8-13-12(15(19)21)6-10(7-14(13)17)16(18)4-5-16;1-3-2-4/h6-7,9,11H,2-5,8,18H2,1H3;2H,1H3,(H,3,4).
What are the key properties of 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide?
2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide has a molecular weight of 365.86 g/mol, XLogP of 1.97, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1-aminocyclopropyl)-7-chloro-3-oxo-1H-isoindol-2-yl]pentanal;N-methylformamide is sourced from PubChem (CID 177243621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).