About carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate
carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate (PubChem CID 177243789) has the molecular formula C10H12N4O2
and a molecular weight of 220.23 g/mol. Its IUPAC name is carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate.
Molecular Properties
| Compound Name | carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate |
| PubChem CID | 177243789 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate |
| SMILES | [H]/N=C(\O/C(N)=N/[H])c1ccc(OC2CC2)nc1 |
| InChI | InChI=1S/C10H12N4O2/c11-9(16-10(12)13)6-1-4-8(14-5-6)15-7-2-3-7/h1,4-5,7,11H,2-3H2,(H3,12,13)/b11-9- |
| InChIKey | JQMLKWDICPYEPM-LUAWRHEFSA-N |
| XLogP | 0.86 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate?
The IUPAC name of carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate (CID 177243789) is carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate.
What is the SMILES notation for carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate?
The canonical SMILES for carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate is [H]/N=C(\O/C(N)=N/[H])c1ccc(OC2CC2)nc1.
What is the InChIKey of carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate?
The InChIKey is JQMLKWDICPYEPM-LUAWRHEFSA-N. The full InChI is InChI=1S/C10H12N4O2/c11-9(16-10(12)13)6-1-4-8(14-5-6)15-7-2-3-7/h1,4-5,7,11H,2-3H2,(H3,12,13)/b11-9-.
What are the key properties of carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate?
carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate has a molecular weight of 220.23 g/mol, XLogP of 0.86, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbamimidoyl 6-cyclopropyloxypyridine-3-carboximidate is sourced from PubChem (CID 177243789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).