C10H13ClN4O2 — CID 177244085
(3S)-1-(4-amino-2-chloropyrimidin-5-yl)piperidine-3-carboxylic acid (PubChem CID 177244085) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is (3S)-1-(4-amino-2-chloropyrimidin-5-yl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(4-amino-2-chloropyrimidin-5-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 177244085 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (3S)-1-(4-amino-2-chloropyrimidin-5-yl)piperidine-3-carboxylic acid |
| SMILES | Nc1nc(Cl)ncc1N1CCC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H13ClN4O2/c11-10-13-4-7(8(12)14-10)15-3-1-2-6(5-15)9(16)17/h4,6H,1-3,5H2,(H,16,17)(H2,12,13,14)/t6-/m0/s1 |
| InChIKey | ONMUAVHGCYMYDD-LURJTMIESA-N |
| XLogP | 1.01 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |