C24H17FNO3P — CID 177244499
[4-[3-(2-fluorocarbazol-9-yl)phenyl]phenyl]phosphonic acid (PubChem CID 177244499) has the molecular formula C24H17FNO3P and a molecular weight of 417.38 g/mol. Its IUPAC name is [4-[3-(2-fluorocarbazol-9-yl)phenyl]phenyl]phosphonic acid.
| Compound Name | [4-[3-(2-fluorocarbazol-9-yl)phenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 177244499 |
| Molecular Formula | C24H17FNO3P |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [4-[3-(2-fluorocarbazol-9-yl)phenyl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(-c2cccc(-n3c4ccccc4c4ccc(F)cc43)c2)cc1 |
| InChI | InChI=1S/C24H17FNO3P/c25-18-10-13-22-21-6-1-2-7-23(21)26(24(22)15-18)19-5-3-4-17(14-19)16-8-11-20(12-9-16)30(27,28)29/h1-15H,(H2,27,28,29) |
| InChIKey | YEIJWJMQDMTYRF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|