C24H27N3O4 — CID 177244684
methyl 3-[4-[3-(morpholine-4-carbonyl)pyrrolo[3,2-b]pyridin-1-yl]butyl]benzoate (PubChem CID 177244684) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is methyl 3-[4-[3-(morpholine-4-carbonyl)pyrrolo[3,2-b]pyridin-1-yl]butyl]benzoate.
| Compound Name | methyl 3-[4-[3-(morpholine-4-carbonyl)pyrrolo[3,2-b]pyridin-1-yl]butyl]benzoate |
|---|---|
| PubChem CID | 177244684 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | methyl 3-[4-[3-(morpholine-4-carbonyl)pyrrolo[3,2-b]pyridin-1-yl]butyl]benzoate |
| SMILES | COC(=O)c1cccc(CCCCn2cc(C(=O)N3CCOCC3)c3ncccc32)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-30-24(29)19-8-4-7-18(16-19)6-2-3-11-27-17-20(22-21(27)9-5-10-25-22)23(28)26-12-14-31-15-13-26/h4-5,7-10,16-17H,2-3,6,11-15H2,1H3 |
| InChIKey | CWZDXLUGVUVGPP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|