C27H16Cl2F4N2O2 — CID 177245037
2,3-dichloro-4-[2-fluoro-4-methoxy-5-[3-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]phenyl]phenyl]aniline (PubChem CID 177245037) has the molecular formula C27H16Cl2F4N2O2 and a molecular weight of 547.34 g/mol. Its IUPAC name is 2,3-dichloro-4-[2-fluoro-4-methoxy-5-[3-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]phenyl]phenyl]aniline.
| Compound Name | 2,3-dichloro-4-[2-fluoro-4-methoxy-5-[3-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 177245037 |
| Molecular Formula | C27H16Cl2F4N2O2 |
| Molecular Weight | 547.34 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 2,3-dichloro-4-[2-fluoro-4-methoxy-5-[3-[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]phenyl]phenyl]aniline |
| SMILES | COc1cc(F)c(-c2ccc(N)c(Cl)c2Cl)cc1-c1cccc(-c2nc3cc(C(F)(F)F)ccc3o2)c1 |
| InChI | InChI=1S/C27H16Cl2F4N2O2/c1-36-23-12-19(30)18(16-6-7-20(34)25(29)24(16)28)11-17(23)13-3-2-4-14(9-13)26-35-21-10-15(27(31,32)33)5-8-22(21)37-26/h2-12H,34H2,1H3 |
| InChIKey | HYPWIKANRCLIDY-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.34 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|