C15H20F2N4O4 — CID 177245902
4-N-(2,2-difluoroethyl)-2-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-nitropyridine-2,4-diamine (PubChem CID 177245902) has the molecular formula C15H20F2N4O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-N-(2,2-difluoroethyl)-2-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-nitropyridine-2,4-diamine.
| Compound Name | 4-N-(2,2-difluoroethyl)-2-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-nitropyridine-2,4-diamine |
|---|---|
| PubChem CID | 177245902 |
| Molecular Formula | C15H20F2N4O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-N-(2,2-difluoroethyl)-2-N-(1,4-dioxaspiro[4.5]decan-8-yl)-5-nitropyridine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NC2CCC3(CC2)OCCO3)cc1NCC(F)F |
| InChI | InChI=1S/C15H20F2N4O4/c16-13(17)9-18-11-7-14(19-8-12(11)21(22)23)20-10-1-3-15(4-2-10)24-5-6-25-15/h7-8,10,13H,1-6,9H2,(H2,18,19,20) |
| InChIKey | LLTCPZGVXIEXKK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|