C17H19ClN6O2 — CID 177246636
5-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde (PubChem CID 177246636) has the molecular formula C17H19ClN6O2 and a molecular weight of 374.83 g/mol. Its IUPAC name is 5-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde.
| Compound Name | 5-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 177246636 |
| Molecular Formula | C17H19ClN6O2 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 5-[[(4R,6S)-12-chloro-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde |
| SMILES | CC[C@]12CNc3nnc(Cl)cc3N1C[C@H](Oc1ncc(C=O)nc1C)C2 |
| InChI | InChI=1S/C17H19ClN6O2/c1-3-17-5-12(26-16-10(2)21-11(8-25)6-19-16)7-24(17)13-4-14(18)22-23-15(13)20-9-17/h4,6,8,12H,3,5,7,9H2,1-2H3,(H,20,23)/t12-,17+/m1/s1 |
| InChIKey | UPUGSBSXOMMLDM-PXAZEXFGSA-N |
| XLogP | 2.27 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|