About (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate
(3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate (PubChem CID 177246744) has the molecular formula C40H60O8
and a molecular weight of 668.91 g/mol. Its IUPAC name is (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate.
Molecular Properties
| Compound Name | (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate |
| PubChem CID | 177246744 |
| Molecular Formula | C40H60O8 |
| Molecular Weight | 668.91 g/mol |
| Exact Mass | 668.43 |
| IUPAC Name | (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate |
| SMILES | CCCCCC(=O)Oc1cc(C)cc(OC(=O)CCCCC)c1.CCCCCCC(=O)Oc1cc(C)cc(OC(=O)CCCCCC)c1 |
| InChI | InChI=1S/C21H32O4.C19H28O4/c1-4-6-8-10-12-20(22)24-18-14-17(3)15-19(16-18)25-21(23)13-11-9-7-5-2;1-4-6-8-10-18(20)22-16-12-15(3)13-17(14-16)23-19(21)11-9-7-5-2/h14-16H,4-13H2,1-3H3;12-14H,4-11H2,1-3H3 |
| InChIKey | YNCLYJOCFCCQLV-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.91 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate?
The IUPAC name of (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate (CID 177246744) is (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate.
What is the SMILES notation for (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate?
The canonical SMILES for (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate is CCCCCC(=O)Oc1cc(C)cc(OC(=O)CCCCC)c1.CCCCCCC(=O)Oc1cc(C)cc(OC(=O)CCCCCC)c1.
What is the InChIKey of (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate?
The InChIKey is YNCLYJOCFCCQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O4.C19H28O4/c1-4-6-8-10-12-20(22)24-18-14-17(3)15-19(16-18)25-21(23)13-11-9-7-5-2;1-4-6-8-10-18(20)22-16-12-15(3)13-17(14-16)23-19(21)11-9-7-5-2/h14-16H,4-13H2,1-3H3;12-14H,4-11H2,1-3H3.
What are the key properties of (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate?
(3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate has a molecular weight of 668.91 g/mol, XLogP of 10.71, 22 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-heptanoyloxy-5-methylphenyl) heptanoate;(3-hexanoyloxy-5-methylphenyl) hexanoate is sourced from PubChem (CID 177246744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).