C24H38N2O8S — CID 177247072
tert-butyl 3-[2-[2-[2-[[3-methoxy-4-(prop-2-ynylamino)phenyl]sulfonyl-methylamino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 177247072) has the molecular formula C24H38N2O8S and a molecular weight of 514.64 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[[3-methoxy-4-(prop-2-ynylamino)phenyl]sulfonyl-methylamino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[[3-methoxy-4-(prop-2-ynylamino)phenyl]sulfonyl-methylamino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 177247072 |
| Molecular Formula | C24H38N2O8S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[[3-methoxy-4-(prop-2-ynylamino)phenyl]sulfonyl-methylamino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | C#CCNc1ccc(S(=O)(=O)N(C)CCOCCOCCOCCC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C24H38N2O8S/c1-7-11-25-21-9-8-20(19-22(21)30-6)35(28,29)26(5)12-14-32-16-18-33-17-15-31-13-10-23(27)34-24(2,3)4/h1,8-9,19,25H,10-18H2,2-6H3 |
| InChIKey | RMTWTQVPNCEVJX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|