C17H19N3O2 — CID 177247292
1-[(2Z,4Z)-2-aminohepta-2,4,6-trienyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-one (PubChem CID 177247292) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[(2Z,4Z)-2-aminohepta-2,4,6-trienyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-one.
| Compound Name | 1-[(2Z,4Z)-2-aminohepta-2,4,6-trienyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 177247292 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-[(2Z,4Z)-2-aminohepta-2,4,6-trienyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridin-2-one |
| SMILES | C=C/C=C\C=C(/N)Cn1cc(-c2c(C)noc2C)ccc1=O |
| InChI | InChI=1S/C17H19N3O2/c1-4-5-6-7-15(18)11-20-10-14(8-9-16(20)21)17-12(2)19-22-13(17)3/h4-10H,1,11,18H2,2-3H3/b6-5-,15-7- |
| InChIKey | HYPZPIIYJSMLMW-NDEWXPFSSA-N |
| XLogP | 2.70 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|