About 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine
1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine (PubChem CID 177247486) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine |
| PubChem CID | 177247486 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine |
| SMILES | C=C/N=C(\C=C)N1CCC(N)C1 |
| InChI | InChI=1S/C9H15N3/c1-3-9(11-4-2)12-6-5-8(10)7-12/h3-4,8H,1-2,5-7,10H2/b11-9+ |
| InChIKey | JBIBRFBNDKZNEU-PKNBQFBNSA-N |
| XLogP | 0.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine?
The IUPAC name of 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine (CID 177247486) is 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine.
What is the SMILES notation for 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine?
The canonical SMILES for 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine is C=C/N=C(\C=C)N1CCC(N)C1.
What is the InChIKey of 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine?
The InChIKey is JBIBRFBNDKZNEU-PKNBQFBNSA-N. The full InChI is InChI=1S/C9H15N3/c1-3-9(11-4-2)12-6-5-8(10)7-12/h3-4,8H,1-2,5-7,10H2/b11-9+.
What are the key properties of 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine?
1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine has a molecular weight of 165.24 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[C,N-bis(ethenyl)carbonimidoyl]pyrrolidin-3-amine is sourced from PubChem (CID 177247486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).