C31H44O4Si — CID 177248761
tert-butyl-[[(2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane (PubChem CID 177248761) has the molecular formula C31H44O4Si and a molecular weight of 508.78 g/mol. Its IUPAC name is tert-butyl-[[(2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 177248761 |
| Molecular Formula | C31H44O4Si |
| Molecular Weight | 508.78 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | tert-butyl-[[(2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxan-2-yl]methoxy]-diphenylsilane |
| SMILES | C=CC[C@H]1CCC[C@@](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(C[C@@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C31H44O4Si/c1-7-15-25-16-14-21-31(35-25,22-26-23-32-30(5,6)34-26)24-33-36(29(2,3)4,27-17-10-8-11-18-27)28-19-12-9-13-20-28/h7-13,17-20,25-26H,1,14-16,21-24H2,2-6H3/t25-,26+,31-/m0/s1 |
| InChIKey | HTVIPPZHJHSBTQ-HEHLMWRFSA-N |
| XLogP | 5.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.78 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|