About [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate
[4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 177248989) has the molecular formula C12H20F3NO3
and a molecular weight of 283.29 g/mol. Its IUPAC name is [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate |
| PubChem CID | 177248989 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(CO)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3NO3/c1-10(2,3)9(18)19-16-6-4-11(8-17,5-7-16)12(13,14)15/h17H,4-8H2,1-3H3 |
| InChIKey | WIXSVODLZHTZLX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate?
The IUPAC name of [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate (CID 177248989) is [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)ON1CCC(CO)(C(F)(F)F)CC1.
What is the InChIKey of [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate?
The InChIKey is WIXSVODLZHTZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO3/c1-10(2,3)9(18)19-16-6-4-11(8-17,5-7-16)12(13,14)15/h17H,4-8H2,1-3H3.
What are the key properties of [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate?
[4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate has a molecular weight of 283.29 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)-4-(trifluoromethyl)piperidin-1-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 177248989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).