About 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide
2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide (PubChem CID 177249352) has the molecular formula C16H23N3O3S
and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide |
| PubChem CID | 177249352 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide |
| SMILES | CC(C)(C)c1ncc(C(=O)N[C@H](/C=C/S(C)(=O)=O)C2CC2)cn1 |
| InChI | InChI=1S/C16H23N3O3S/c1-16(2,3)15-17-9-12(10-18-15)14(20)19-13(11-5-6-11)7-8-23(4,21)22/h7-11,13H,5-6H2,1-4H3,(H,19,20)/b8-7+/t13-/m1/s1 |
| InChIKey | FJZTXCNPWRAMFK-SBDDDAINSA-N |
| XLogP | 1.84 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide?
The IUPAC name of 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide (CID 177249352) is 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide.
What is the SMILES notation for 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide?
The canonical SMILES for 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide is CC(C)(C)c1ncc(C(=O)N[C@H](/C=C/S(C)(=O)=O)C2CC2)cn1.
What is the InChIKey of 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide?
The InChIKey is FJZTXCNPWRAMFK-SBDDDAINSA-N. The full InChI is InChI=1S/C16H23N3O3S/c1-16(2,3)15-17-9-12(10-18-15)14(20)19-13(11-5-6-11)7-8-23(4,21)22/h7-11,13H,5-6H2,1-4H3,(H,19,20)/b8-7+/t13-/m1/s1.
What are the key properties of 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide?
2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide has a molecular weight of 337.45 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-[(E,1S)-1-cyclopropyl-3-methylsulfonylprop-2-enyl]pyrimidine-5-carboxamide is sourced from PubChem (CID 177249352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).