About 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine
2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine (PubChem CID 177249993) has the molecular formula C12H14N4S
and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine.
Molecular Properties
| Compound Name | 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine |
| PubChem CID | 177249993 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine |
| SMILES | Nc1cncc2ccc(N3CCSCC3)nc12 |
| InChI | InChI=1S/C12H14N4S/c13-10-8-14-7-9-1-2-11(15-12(9)10)16-3-5-17-6-4-16/h1-2,7-8H,3-6,13H2 |
| InChIKey | XCMDQRAFLCTUEL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine?
The IUPAC name of 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine (CID 177249993) is 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine.
What is the SMILES notation for 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine?
The canonical SMILES for 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine is Nc1cncc2ccc(N3CCSCC3)nc12.
What is the InChIKey of 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine?
The InChIKey is XCMDQRAFLCTUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4S/c13-10-8-14-7-9-1-2-11(15-12(9)10)16-3-5-17-6-4-16/h1-2,7-8H,3-6,13H2.
What are the key properties of 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine?
2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine has a molecular weight of 246.34 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiomorpholin-4-yl-1,6-naphthyridin-8-amine is sourced from PubChem (CID 177249993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).