About [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate
[(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate (PubChem CID 177250850) has the molecular formula C18H12N2O4S
and a molecular weight of 352.37 g/mol. Its IUPAC name is [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate.
Molecular Properties
| Compound Name | [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate |
| PubChem CID | 177250850 |
| Molecular Formula | C18H12N2O4S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate |
| SMILES | C/C(=N\OC(=O)c1ccc(C#N)cc1)C1=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H12N2O4S/c1-12(16-11-25(22,23)17-5-3-2-4-15(16)17)20-24-18(21)14-8-6-13(10-19)7-9-14/h2-9,11H,1H3/b20-12+ |
| InChIKey | UQCGUNLEPYVOKM-UDWIEESQSA-N |
| XLogP | 2.92 |
| TPSA | 96.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate?
The IUPAC name of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate (CID 177250850) is [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate.
What is the SMILES notation for [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate?
The canonical SMILES for [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate is C/C(=N\OC(=O)c1ccc(C#N)cc1)C1=CS(=O)(=O)c2ccccc21.
What is the InChIKey of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate?
The InChIKey is UQCGUNLEPYVOKM-UDWIEESQSA-N. The full InChI is InChI=1S/C18H12N2O4S/c1-12(16-11-25(22,23)17-5-3-2-4-15(16)17)20-24-18(21)14-8-6-13(10-19)7-9-14/h2-9,11H,1H3/b20-12+.
What are the key properties of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate?
[(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate has a molecular weight of 352.37 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 4-cyanobenzoate is sourced from PubChem (CID 177250850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).