About N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide
N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide (PubChem CID 177250911) has the molecular formula C20H17BrF3N3O
and a molecular weight of 452.27 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide |
| PubChem CID | 177250911 |
| Molecular Formula | C20H17BrF3N3O |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide |
| SMILES | Cc1c(N(C)C(=O)c2ccc(C(F)(F)F)cc2)nn(C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H17BrF3N3O/c1-12-17(13-6-10-16(21)11-7-13)27(3)25-18(12)26(2)19(28)14-4-8-15(9-5-14)20(22,23)24/h4-11H,1-3H3 |
| InChIKey | UFBHMGUSWKWZBJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide?
The IUPAC name of N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide (CID 177250911) is N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide?
The canonical SMILES for N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide is Cc1c(N(C)C(=O)c2ccc(C(F)(F)F)cc2)nn(C)c1-c1ccc(Br)cc1.
What is the InChIKey of N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide?
The InChIKey is UFBHMGUSWKWZBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BrF3N3O/c1-12-17(13-6-10-16(21)11-7-13)27(3)25-18(12)26(2)19(28)14-4-8-15(9-5-14)20(22,23)24/h4-11H,1-3H3.
What are the key properties of N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide?
N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide has a molecular weight of 452.27 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(4-bromophenyl)-1,4-dimethylpyrazol-3-yl]-N-methyl-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 177250911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).