C25H35ClF3N3O6 — CID 177250957
[3-chloro-5-[3-[[(2S)-4,4,4-trifluorobutan-2-yl]carbamoyloxy]cyclopentyl]-2-pyridinyl]carbamoyl 2,4,4-trimethylpentan-2-yl carbonate (PubChem CID 177250957) has the molecular formula C25H35ClF3N3O6 and a molecular weight of 566.02 g/mol. Its IUPAC name is [3-chloro-5-[3-[[(2S)-4,4,4-trifluorobutan-2-yl]carbamoyloxy]cyclopentyl]-2-pyridinyl]carbamoyl 2,4,4-trimethylpentan-2-yl carbonate.
| Compound Name | [3-chloro-5-[3-[[(2S)-4,4,4-trifluorobutan-2-yl]carbamoyloxy]cyclopentyl]-2-pyridinyl]carbamoyl 2,4,4-trimethylpentan-2-yl carbonate |
|---|---|
| PubChem CID | 177250957 |
| Molecular Formula | C25H35ClF3N3O6 |
| Molecular Weight | 566.02 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | [3-chloro-5-[3-[[(2S)-4,4,4-trifluorobutan-2-yl]carbamoyloxy]cyclopentyl]-2-pyridinyl]carbamoyl 2,4,4-trimethylpentan-2-yl carbonate |
| SMILES | C[C@@H](CC(F)(F)F)NC(=O)OC1CCC(c2cnc(NC(=O)OC(=O)OC(C)(C)CC(C)(C)C)c(Cl)c2)C1 |
| InChI | InChI=1S/C25H35ClF3N3O6/c1-14(11-25(27,28)29)31-20(33)36-17-8-7-15(9-17)16-10-18(26)19(30-12-16)32-21(34)37-22(35)38-24(5,6)13-23(2,3)4/h10,12,14-15,17H,7-9,11,13H2,1-6H3,(H,31,33)(H,30,32,34)/t14-,15?,17?/m0/s1 |
| InChIKey | UKBWMHJKAVZONS-UQPPLGOBSA-N |
| XLogP | 7.34 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.02 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|