C21H28F3NO4 — CID 177252039
tert-butyl 5-[[1-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]pentanoate (PubChem CID 177252039) has the molecular formula C21H28F3NO4 and a molecular weight of 415.45 g/mol. Its IUPAC name is tert-butyl 5-[[1-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]pentanoate.
| Compound Name | tert-butyl 5-[[1-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]pentanoate |
|---|---|
| PubChem CID | 177252039 |
| Molecular Formula | C21H28F3NO4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | tert-butyl 5-[[1-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]pentanoate |
| SMILES | CC1c2cc(OCCCCC(=O)OC(C)(C)C)ccc2CCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H28F3NO4/c1-14-17-13-16(28-12-6-5-7-18(26)29-20(2,3)4)9-8-15(17)10-11-25(14)19(27)21(22,23)24/h8-9,13-14H,5-7,10-12H2,1-4H3 |
| InChIKey | HQWFJYIEGSTWHM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|