C30H39F3N4O — CID 177252544
5-[(3E,7E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]pyridazin-3-one (PubChem CID 177252544) has the molecular formula C30H39F3N4O and a molecular weight of 528.66 g/mol. Its IUPAC name is 5-[(3E,7E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]pyridazin-3-one.
| Compound Name | 5-[(3E,7E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 177252544 |
| Molecular Formula | C30H39F3N4O |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 5-[(3E,7E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]pyridazin-3-one |
| SMILES | CC1=C(CC/C(C)=C/CC/C(C)=C/CCc2cnn(-c3nccc(C(F)(F)F)n3)c(=O)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H39F3N4O/c1-21(9-6-10-22(2)14-15-25-23(3)12-8-17-29(25,4)5)11-7-13-24-19-27(38)37(35-20-24)28-34-18-16-26(36-28)30(31,32)33/h10-11,16,18-20H,6-9,12-15,17H2,1-5H3/b21-11+,22-10+ |
| InChIKey | NTTOEDSGGYSCFT-LRQJTZJKSA-N |
| XLogP | 7.95 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|