About 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine
1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine (PubChem CID 177252638) has the molecular formula C13H16BrFN2
and a molecular weight of 299.19 g/mol. Its IUPAC name is 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine.
Molecular Properties
| Compound Name | 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine |
| PubChem CID | 177252638 |
| Molecular Formula | C13H16BrFN2 |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine |
| SMILES | F[C@H]1Cc2cc(Br)ccc2[C@H]1N1CCNCC1 |
| InChI | InChI=1S/C13H16BrFN2/c14-10-1-2-11-9(7-10)8-12(15)13(11)17-5-3-16-4-6-17/h1-2,7,12-13,16H,3-6,8H2/t12-,13+/m0/s1 |
| InChIKey | RJYLIDKDFJQAGI-QWHCGFSZSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine?
The IUPAC name of 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine (CID 177252638) is 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine.
What is the SMILES notation for 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine?
The canonical SMILES for 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine is F[C@H]1Cc2cc(Br)ccc2[C@H]1N1CCNCC1.
What is the InChIKey of 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine?
The InChIKey is RJYLIDKDFJQAGI-QWHCGFSZSA-N. The full InChI is InChI=1S/C13H16BrFN2/c14-10-1-2-11-9(7-10)8-12(15)13(11)17-5-3-16-4-6-17/h1-2,7,12-13,16H,3-6,8H2/t12-,13+/m0/s1.
What are the key properties of 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine?
1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine has a molecular weight of 299.19 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-5-bromo-2-fluoro-2,3-dihydro-1H-inden-1-yl]piperazine is sourced from PubChem (CID 177252638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).