C21H27FN4O2 — CID 177254021
3-fluoro-4-[4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]piperazin-1-yl]aniline (PubChem CID 177254021) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-fluoro-4-[4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]piperazin-1-yl]aniline.
| Compound Name | 3-fluoro-4-[4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 177254021 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-fluoro-4-[4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]piperazin-1-yl]aniline |
| SMILES | Cc1ncc(CN2CCN(c3ccc(N)cc3F)CC2)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C21H27FN4O2/c1-14-20-17(13-27-21(2,3)28-20)15(11-24-14)12-25-6-8-26(9-7-25)19-5-4-16(23)10-18(19)22/h4-5,10-11H,6-9,12-13,23H2,1-3H3 |
| InChIKey | FHNSWUQOVDGXLX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|