About 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide
5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide (PubChem CID 177254462) has the molecular formula C8H5F3N2O4S
and a molecular weight of 282.20 g/mol. Its IUPAC name is 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide.
Molecular Properties
| Compound Name | 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide |
| PubChem CID | 177254462 |
| Molecular Formula | C8H5F3N2O4S |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cc(C(F)(F)F)on2)o1 |
| InChI | InChI=1S/C8H5F3N2O4S/c9-8(10,11)6-3-4(13-17-6)5-1-2-7(16-5)18(12,14)15/h1-3H,(H2,12,14,15) |
| InChIKey | KSCSLJAOKQGLJN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide?
The IUPAC name of 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide (CID 177254462) is 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide.
What is the SMILES notation for 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide?
The canonical SMILES for 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide is NS(=O)(=O)c1ccc(-c2cc(C(F)(F)F)on2)o1.
What is the InChIKey of 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide?
The InChIKey is KSCSLJAOKQGLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2O4S/c9-8(10,11)6-3-4(13-17-6)5-1-2-7(16-5)18(12,14)15/h1-3H,(H2,12,14,15).
What are the key properties of 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide?
5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide has a molecular weight of 282.20 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(trifluoromethyl)-1,2-oxazol-3-yl]furan-2-sulfonamide is sourced from PubChem (CID 177254462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).